![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[IMG]](/icons/image2.gif) | zellweger.jpg | 2020-08-11 14:00 | 13K | |
![[TXT]](/icons/text.gif) | zellweger.html | 2020-08-11 14:00 | 2.2K | |
![[VID]](/icons/movie.gif) | zellweger-dialup.wmv | 2020-08-11 14:00 | 1.7M | |
![[VID]](/icons/movie.gif) | zellweger-dialup.mov | 2020-08-11 14:00 | 31M | |
![[VID]](/icons/movie.gif) | zellweger-broadband.wmv | 2020-08-11 14:00 | 33M | |
![[IMG]](/icons/image2.gif) | yes.gif | 2020-08-11 14:00 | 1.0K | |
![[IMG]](/icons/image2.gif) | window.JPG | 2020-08-11 14:00 | 85K | |
![[IMG]](/icons/image2.gif) | window-cropped.JPG | 2020-08-11 14:00 | 59K | |
![[ ]](/icons/unknown.gif) | wilderness sides.doc | 2020-08-11 14:00 | 34K | |
![[ ]](/icons/unknown.gif) | wilderness.rtf | 2020-08-11 14:00 | 445K | |
![[TXT]](/icons/text.gif) | wilderness.html | 2020-08-11 14:00 | 595 | |
![[ ]](/icons/unknown.gif) | wiki.phtml | 2020-08-11 14:00 | 86 | |
![[ ]](/icons/unknown.gif) | wiki.db | 2020-08-11 14:00 | 0 | |
![[TXT]](/icons/text.gif) | why-zellweger.html | 2020-08-11 14:00 | 2.1K | |
![[TXT]](/icons/text.gif) | why-gotterdammerung.html | 2020-08-11 14:00 | 1.0K | |
![[TXT]](/icons/text.gif) | why-body-boundary.html | 2020-08-11 14:00 | 2.2K | |
![[IMG]](/icons/image2.gif) | welcomepitch.gif | 2020-08-11 14:00 | 44K | |
![[TXT]](/icons/text.gif) | welcome.html | 2020-08-11 14:00 | 1.7K | |
![[IMG]](/icons/image2.gif) | wall street.gif | 2020-08-11 14:00 | 1.6K | |
![[IMG]](/icons/image2.gif) | upset hag.jpg | 2020-08-11 14:00 | 5.7K | |
![[IMG]](/icons/image2.gif) | underneath5.JPG | 2020-08-11 14:00 | 4.3K | |
![[IMG]](/icons/image2.gif) | underneath4.JPG | 2020-08-11 14:00 | 3.4K | |
![[IMG]](/icons/image2.gif) | underneath3.JPG | 2020-08-11 14:00 | 5.2K | |
![[IMG]](/icons/image2.gif) | underneath3-big.JPG | 2020-08-11 14:00 | 22K | |
![[IMG]](/icons/image2.gif) | underneath2.JPG | 2020-08-11 14:00 | 6.3K | |
![[IMG]](/icons/image2.gif) | underneath1.JPG | 2020-08-11 14:00 | 6.9K | |
![[VID]](/icons/movie.gif) | underneath.wmv | 2020-08-11 14:00 | 23M | |
![[TXT]](/icons/text.gif) | underneath.html | 2020-08-11 14:00 | 1.9K | |
![[VID]](/icons/movie.gif) | underneath-stream.wmv | 2020-08-11 14:00 | 11M | |
![[VID]](/icons/movie.gif) | underneath-stream.mov | 2020-08-11 14:00 | 74M | |
![[VID]](/icons/movie.gif) | under a dream- rough cut.wmv | 2020-08-11 14:00 | 13M | |
![[IMG]](/icons/image2.gif) | under-a-dream3.bmp | 2020-08-11 14:00 | 167K | |
![[IMG]](/icons/image2.gif) | under-a-dream3.JPG | 2020-08-11 14:00 | 7.9K | |
![[VID]](/icons/movie.gif) | under-a-dream2.wmv | 2020-08-11 14:00 | 30M | |
![[VID]](/icons/movie.gif) | under-a-dream.wmv | 2020-08-11 14:00 | 11M | |
![[TXT]](/icons/text.gif) | under-a-dream.html | 2020-08-11 14:00 | 2.0K | |
![[IMG]](/icons/image2.gif) | under-a-dream.JPG | 2020-08-11 14:00 | 15K | |
![[IMG]](/icons/image2.gif) | true-thug-nature.JPG | 2020-08-11 14:00 | 93K | |
![[VID]](/icons/movie.gif) | trophy.wmv | 2020-08-11 14:00 | 91M | |
![[TXT]](/icons/text.gif) | trophy.html | 2020-08-11 14:00 | 1.5K | |
![[IMG]](/icons/image2.gif) | trophy.bmp | 2020-08-11 14:00 | 146K | |
![[IMG]](/icons/image2.gif) | tired.gif | 2020-08-11 14:00 | 1.4K | |
![[ ]](/icons/unknown.gif) | thumb_handler.php5 | 2020-08-11 14:00 | 37 | |
![[ ]](/icons/unknown.gif) | thumb_handler.php | 2020-08-11 14:00 | 229 | |
![[ ]](/icons/unknown.gif) | thumb.php5 | 2020-08-11 14:00 | 29 | |
![[ ]](/icons/unknown.gif) | thumb.php | 2020-08-11 14:00 | 9.4K | |
![[IMG]](/icons/image2.gif) | text_pic.jpg | 2020-08-11 14:00 | 53K | |
![[DIR]](/icons/folder.gif) | tests/ | 2020-08-11 14:00 | - | |
![[IMG]](/icons/image2.gif) | test.gif | 2020-08-11 14:00 | 5.8K | |
![[DIR]](/icons/folder.gif) | tea/ | 2020-08-11 14:00 | - | |
![[IMG]](/icons/image2.gif) | tags4.JPG | 2020-08-11 14:00 | 89K | |
![[IMG]](/icons/image2.gif) | tags3.JPG | 2020-08-11 14:00 | 77K | |
![[IMG]](/icons/image2.gif) | tags3-cropped.JPG | 2020-08-11 14:00 | 68K | |
![[IMG]](/icons/image2.gif) | tags2.JPG | 2020-08-11 14:00 | 91K | |
![[IMG]](/icons/image2.gif) | tags1.JPG | 2020-08-11 14:00 | 73K | |
![[IMG]](/icons/image2.gif) | tags1-cropped.JPG | 2020-08-11 14:00 | 55K | |
![[IMG]](/icons/image2.gif) | sword_master.jpg | 2020-08-11 14:00 | 28K | |
![[IMG]](/icons/image2.gif) | still9.JPG | 2020-08-11 14:00 | 14K | |
![[IMG]](/icons/image2.gif) | still8.JPG | 2020-08-11 14:00 | 9.3K | |
![[IMG]](/icons/image2.gif) | still7.JPG | 2020-08-11 14:00 | 19K | |
![[IMG]](/icons/image2.gif) | still6.JPG | 2020-08-11 14:00 | 15K | |
![[IMG]](/icons/image2.gif) | still4.JPG | 2020-08-11 14:00 | 16K | |
![[IMG]](/icons/image2.gif) | still2.JPG | 2020-08-11 14:00 | 12K | |
![[IMG]](/icons/image2.gif) | still1.JPG | 2020-08-11 14:00 | 8.7K | |
![[IMG]](/icons/image2.gif) | starmontage.jpg | 2020-08-11 14:00 | 24K | |
![[IMG]](/icons/image2.gif) | stairs-tree.JPG | 2020-08-11 14:00 | 93K | |
![[TXT]](/icons/text.gif) | sqlite3ext.h | 2020-08-11 14:00 | 24K | |
![[ ]](/icons/unknown.gif) | sqlite3.pc.in | 2020-08-11 14:00 | 267 | |
![[ ]](/icons/unknown.gif) | sqlite3.pc | 2020-08-11 14:00 | 278 | |
![[TXT]](/icons/text.gif) | sqlite3.h | 2020-08-11 14:00 | 332K | |
![[TXT]](/icons/text.gif) | sqlite3.c | 2020-08-11 14:00 | 4.6M | |
![[ ]](/icons/unknown.gif) | sqlite3.1 | 2020-08-11 14:00 | 6.6K | |
![[ ]](/icons/unknown.gif) | sqlite3 | 2020-08-11 14:00 | 456K | |
![[IMG]](/icons/image2.gif) | small galaxy robin.jpg | 2020-08-11 14:00 | 7.2K | |
![[IMG]](/icons/image2.gif) | small galaxy.jpg | 2020-08-11 14:00 | 7.1K | |
![[DIR]](/icons/folder.gif) | skins/ | 2020-08-11 14:00 | - | |
![[IMG]](/icons/image2.gif) | shoe.jpg | 2020-08-11 14:00 | 11K | |
![[TXT]](/icons/text.gif) | shell.c | 2020-08-11 14:00 | 94K | |
![[IMG]](/icons/image2.gif) | set3-smaller.jpg | 2020-08-11 14:00 | 66K | |
![[IMG]](/icons/image2.gif) | set2.jpg | 2020-08-11 14:00 | 137K | |
![[DIR]](/icons/folder.gif) | serialized/ | 2020-08-11 14:00 | - | |
![[IMG]](/icons/image2.gif) | selection.gif | 2020-08-11 14:00 | 1.4K | |
![[IMG]](/icons/image2.gif) | sarah.jpg | 2020-08-11 14:00 | 13K | |
![[IMG]](/icons/image2.gif) | roughcut screening.GIF | 2020-08-11 14:00 | 3.1K | |
![[IMG]](/icons/image2.gif) | robin5.JPG | 2020-08-11 14:00 | 3.6K | |
![[IMG]](/icons/image2.gif) | robin4.jpg | 2020-08-11 14:00 | 61K | |
![[IMG]](/icons/image2.gif) | robin2.JPG | 2020-08-11 14:00 | 149K | |
![[TXT]](/icons/text.gif) | robin.html | 2020-08-11 14:00 | 935 | |
![[IMG]](/icons/image2.gif) | robin.bmp | 2020-08-11 14:00 | 8.1K | |
![[IMG]](/icons/image2.gif) | robin-the-boxer.JPG | 2020-08-11 14:00 | 78K | |
![[IMG]](/icons/image2.gif) | robin-text.bmp | 2020-08-11 14:00 | 40K | |
![[IMG]](/icons/image2.gif) | robin-pinkshirt.JPG | 2020-08-11 14:00 | 36K | |
![[IMG]](/icons/image2.gif) | robin-light.JPG | 2020-08-11 14:00 | 91K | |
![[IMG]](/icons/image2.gif) | robin-and-dylan.JPG | 2020-08-11 14:00 | 86K | |
![[IMG]](/icons/image2.gif) | right_arrow.jpg | 2020-08-11 14:00 | 914 | |
![[IMG]](/icons/image2.gif) | reversal.jpg | 2020-08-11 14:00 | 7.7K | |
![[DIR]](/icons/folder.gif) | resources/ | 2020-08-11 14:00 | - | |
![[IMG]](/icons/image2.gif) | reporter-scene.JPG | 2020-08-11 14:00 | 106K | |
![[IMG]](/icons/image2.gif) | rene.jpg | 2020-08-11 14:00 | 6.8K | |
![[DIR]](/icons/folder.gif) | removed-content-bigbadgerjohnny/ | 2020-08-11 14:00 | - | |
![[IMG]](/icons/image2.gif) | redline2.jpg | 2020-08-11 14:00 | 1.5K | |
![[IMG]](/icons/image2.gif) | redline.jpg | 2020-08-11 14:00 | 1.6K | |
![[ ]](/icons/unknown.gif) | redirect.phtml | 2020-08-11 14:00 | 89 | |
![[ ]](/icons/unknown.gif) | redirect.php5 | 2020-08-11 14:00 | 31 | |
![[ ]](/icons/unknown.gif) | redirect.php | 2020-08-11 14:00 | 510 | |
![[IMG]](/icons/image2.gif) | reagan1.gif | 2020-08-11 14:00 | 4.8K | |
![[IMG]](/icons/image2.gif) | reagan.gif | 2020-08-11 14:00 | 1.2K | |
![[IMG]](/icons/image2.gif) | rain_small.jpg | 2020-08-11 14:00 | 30K | |
![[IMG]](/icons/image2.gif) | rain1_small.jpg | 2020-08-11 14:00 | 33K | |
![[IMG]](/icons/image2.gif) | promotional.jpg | 2020-08-11 14:00 | 34K | |
![[IMG]](/icons/image2.gif) | promo_shot.jpg | 2020-08-11 14:00 | 57K | |
![[IMG]](/icons/image2.gif) | promo2.jpg | 2020-08-11 14:00 | 125K | |
![[IMG]](/icons/image2.gif) | promo1.jpg | 2020-08-11 14:00 | 127K | |
![[IMG]](/icons/image2.gif) | promo-stills.bmp | 2020-08-11 14:00 | 6.3K | |
![[ ]](/icons/unknown.gif) | profileinfo.php | 2020-08-11 14:00 | 9.2K | |
![[IMG]](/icons/image2.gif) | picture-strip.JPG | 2020-08-11 14:00 | 31K | |
![[TXT]](/icons/text.gif) | photos10.html | 2020-08-11 14:00 | 568 | |
![[TXT]](/icons/text.gif) | photos9.html | 2020-08-11 14:00 | 570 | |
![[TXT]](/icons/text.gif) | photos8.html | 2020-08-11 14:00 | 569 | |
![[TXT]](/icons/text.gif) | photos7.html | 2020-08-11 14:00 | 569 | |
![[TXT]](/icons/text.gif) | photos6.html | 2020-08-11 14:00 | 560 | |
![[TXT]](/icons/text.gif) | photos5.html | 2020-08-11 14:00 | 568 | |
![[TXT]](/icons/text.gif) | photos4.html | 2020-08-11 14:00 | 560 | |
![[TXT]](/icons/text.gif) | photos3.html | 2020-08-11 14:00 | 568 | |
![[TXT]](/icons/text.gif) | photos2.html | 2020-08-11 14:00 | 560 | |
![[IMG]](/icons/image2.gif) | photos.jpg | 2020-08-11 14:00 | 23K | |
![[TXT]](/icons/text.gif) | photos.html | 2020-08-11 14:00 | 562 | |
![[IMG]](/icons/image2.gif) | photos.bmp | 2020-08-11 14:00 | 3.6K | |
![[TXT]](/icons/text.gif) | photos-gallery.html | 2020-08-11 14:00 | 660 | |
![[IMG]](/icons/image2.gif) | photos-big.bmp | 2020-08-11 14:00 | 8.8K | |
![[IMG]](/icons/image2.gif) | phone.JPG | 2020-08-11 14:00 | 81K | |
![[IMG]](/icons/image2.gif) | people.jpg | 2020-08-11 14:00 | 23K | |
![[TXT]](/icons/text.gif) | people.html | 2020-08-11 14:00 | 824 | |
![[IMG]](/icons/image2.gif) | paul.bmp | 2020-08-11 14:00 | 9.5K | |
![[IMG]](/icons/image2.gif) | paul-text.bmp | 2020-08-11 14:00 | 74K | |
![[IMG]](/icons/image2.gif) | paul-ana-backlight.JPG | 2020-08-11 14:00 | 53K | |
![[IMG]](/icons/image2.gif) | party2.JPG | 2020-08-11 14:00 | 80K | |
![[TXT]](/icons/text.gif) | order.html | 2020-08-11 14:00 | 3.5K | |
![[IMG]](/icons/image2.gif) | or.gif | 2020-08-11 14:00 | 901 | |
![[ ]](/icons/unknown.gif) | opensearch_desc.php5 | 2020-08-11 14:00 | 39 | |
![[ ]](/icons/unknown.gif) | opensearch_desc.php | 2020-08-11 14:00 | 3.0K | |
![[ ]](/icons/unknown.gif) | one_morning.doc | 2020-08-11 14:00 | 137K | |
![[IMG]](/icons/image2.gif) | okay.gif | 2020-08-11 14:00 | 1.5K | |
![[IMG]](/icons/image2.gif) | nun.jpg | 2020-08-11 14:00 | 15K | |
![[TXT]](/icons/text.gif) | no.html | 2020-08-11 14:00 | 725 | |
![[IMG]](/icons/image2.gif) | no.gif | 2020-08-11 14:00 | 969 | |
![[IMG]](/icons/image2.gif) | newspaper still.jpg | 2020-08-11 14:00 | 11K | |
![[IMG]](/icons/image2.gif) | newspaper.jpg | 2020-08-11 14:00 | 2.6K | |
![[TXT]](/icons/text.gif) | news.html | 2020-08-11 14:00 | 1.2K | |
![[IMG]](/icons/image2.gif) | news.bmp | 2020-08-11 14:00 | 3.2K | |
![[ ]](/icons/unknown.gif) | natasha_and_elizabeth.doc | 2020-08-11 14:00 | 30K | |
![[IMG]](/icons/image2.gif) | naked signing.jpg | 2020-08-11 14:00 | 13K | |
![[IMG]](/icons/image2.gif) | naked running.jpg | 2020-08-11 14:00 | 7.0K | |
![[IMG]](/icons/image2.gif) | naked montage.jpg | 2020-08-11 14:00 | 27K | |
![[IMG]](/icons/image2.gif) | naked front still.jpg | 2020-08-11 14:00 | 8.2K | |
![[DIR]](/icons/folder.gif) | mw-config/ | 2020-08-11 14:00 | - | |
![[TXT]](/icons/text.gif) | morefilms.html | 2020-08-11 14:00 | 1.3K | |
![[IMG]](/icons/image2.gif) | montage 6.JPG | 2020-08-11 14:00 | 26K | |
![[IMG]](/icons/image2.gif) | montage 5.JPG | 2020-08-11 14:00 | 36K | |
![[IMG]](/icons/image2.gif) | montage 4.JPG | 2020-08-11 14:00 | 26K | |
![[IMG]](/icons/image2.gif) | montage 3.JPG | 2020-08-11 14:00 | 24K | |
![[IMG]](/icons/image2.gif) | montage 2.JPG | 2020-08-11 14:00 | 26K | |
![[IMG]](/icons/image2.gif) | montage 1.JPG | 2020-08-11 14:00 | 23K | |
![[IMG]](/icons/image2.gif) | montage-2-smaller.JPG | 2020-08-11 14:00 | 8.0K | |
![[ ]](/icons/unknown.gif) | missing | 2020-08-11 14:00 | 11K | |
![[IMG]](/icons/image2.gif) | mcccarthy.jpg | 2020-08-11 14:00 | 5.8K | |
![[VID]](/icons/movie.gif) | marriage-deadline.wmv | 2020-08-11 14:00 | 21M | |
![[TXT]](/icons/text.gif) | marriage-deadline.html | 2020-08-11 14:00 | 1.8K | |
![[IMG]](/icons/image2.gif) | marlyse-small.bmp | 2020-08-11 14:00 | 144K | |
![[DIR]](/icons/folder.gif) | maintenance/ | 2020-08-11 14:00 | - | |
![[IMG]](/icons/image2.gif) | main3.bmp | 2020-08-11 14:00 | 6.4K | |
![[IMG]](/icons/image2.gif) | main2.jpg | 2020-08-11 14:00 | 1.5K | |
![[IMG]](/icons/image2.gif) | main.jpg | 2020-08-11 14:00 | 1.7K | |
![[TXT]](/icons/text.gif) | main.html | 2020-08-11 14:00 | 3.6K | |
![[IMG]](/icons/image2.gif) | magic.jpg | 2020-08-11 14:00 | 14K | |
![[TXT]](/icons/text.gif) | ltmain.sh | 2020-08-11 14:00 | 194K | |
![[ ]](/icons/unknown.gif) | load.php5 | 2020-08-11 14:00 | 27 | |
![[ ]](/icons/unknown.gif) | load.php | 2020-08-11 14:00 | 1.8K | |
![[IMG]](/icons/image2.gif) | listedat_12060_grey.gif | 2020-08-11 14:00 | 858 | |
![[IMG]](/icons/image2.gif) | left_arrow.jpg | 2020-08-11 14:00 | 924 | |
![[TXT]](/icons/text.gif) | lareview2.html | 2020-08-11 14:00 | 702 | |
![[DIR]](/icons/folder.gif) | languages/ | 2020-08-11 14:00 | - | |
![[IMG]](/icons/image2.gif) | lakeside park meeting.JPG | 2020-08-11 14:00 | 76K | |
![[IMG]](/icons/image2.gif) | kelly-small.bmp | 2020-08-11 14:00 | 162K | |
![[IMG]](/icons/image2.gif) | just-in.jpg | 2020-08-11 14:00 | 28K | |
![[ ]](/icons/unknown.gif) | install-sh | 2020-08-11 14:00 | 9.0K | |
![[VID]](/icons/movie.gif) | inside.wmv | 2020-08-11 14:00 | 15M | |
![[TXT]](/icons/text.gif) | inside.html | 2020-08-11 14:00 | 1.8K | |
![[ ]](/icons/unknown.gif) | index.php5 | 2020-08-11 14:00 | 29 | |
![[ ]](/icons/unknown.gif) | index.php | 2020-08-11 14:00 | 2.3K | |
![[TXT]](/icons/text.gif) | index.html.orig | 2020-08-11 14:00 | 559 | |
![[TXT]](/icons/text.gif) | index.html | 2020-08-11 14:00 | 559 | |
![[DIR]](/icons/folder.gif) | includes/ | 2020-08-11 14:00 | - | |
![[ ]](/icons/unknown.gif) | img_auth.php5 | 2020-08-11 14:00 | 31 | |
![[ ]](/icons/unknown.gif) | img_auth.php | 2020-08-11 14:00 | 5.1K | |
![[DIR]](/icons/folder.gif) | images/ | 2020-08-11 14:00 | - | |
![[TXT]](/icons/text.gif) | ideology.html | 2020-08-11 14:00 | 6.1K | |
![[IMG]](/icons/image2.gif) | ideological model.gif | 2020-08-11 14:00 | 1.7K | |
![[VID]](/icons/movie.gif) | humanities preview.wmv | 2020-08-11 14:00 | 2.7M | |
![[TXT]](/icons/text.gif) | humanities.html | 2020-08-11 14:00 | 290 | |
![[IMG]](/icons/image2.gif) | humanities - small.JPG | 2020-08-11 14:00 | 6.8K | |
![[IMG]](/icons/image2.gif) | head-like-a-light.JPG | 2020-08-11 14:00 | 57K | |
![[IMG]](/icons/image2.gif) | hand climbing.jpg | 2020-08-11 14:00 | 8.1K | |
![[IMG]](/icons/image2.gif) | guidelines.gif | 2020-08-11 14:00 | 1.7K | |
![[IMG]](/icons/image2.gif) | government agent.gif | 2020-08-11 14:00 | 1.3K | |
![[IMG]](/icons/image2.gif) | gotterdammerung.jpg | 2020-08-11 14:00 | 12K | |
![[TXT]](/icons/text.gif) | gotterdammerung.html | 2020-08-11 14:00 | 2.4K | |
![[VID]](/icons/movie.gif) | gotterdammerung-dialup.wmv | 2020-08-11 14:00 | 1.2M | |
![[VID]](/icons/movie.gif) | gotterdammerung-dialup.mov | 2020-08-11 14:00 | 27M | |
![[VID]](/icons/movie.gif) | gotterdammerung-broadband.wmv | 2020-08-11 14:00 | 48M | |
![[IMG]](/icons/image2.gif) | good-cigar.JPG | 2020-08-11 14:00 | 68K | |
![[TXT]](/icons/text.gif) | gibberish.txt | 2020-08-11 14:00 | 5.6K | |
![[IMG]](/icons/image2.gif) | gazebo.JPG | 2020-08-11 14:00 | 125K | |
![[IMG]](/icons/image2.gif) | galaxy.jpg | 2020-08-11 14:00 | 3.5K | |
![[TXT]](/icons/text.gif) | g-man.html | 2020-08-11 14:00 | 287 | |
![[IMG]](/icons/image2.gif) | fun-haver.gif | 2020-08-11 14:00 | 2.5K | |
![[DIR]](/icons/folder.gif) | extensions/ | 2020-08-11 14:00 | - | |
![[IMG]](/icons/image2.gif) | dylan.JPG | 2020-08-11 14:00 | 81K | |
![[IMG]](/icons/image2.gif) | dylan-white-to-black.JPG | 2020-08-11 14:00 | 81K | |
![[IMG]](/icons/image2.gif) | dylan-CU.JPG | 2020-08-11 14:00 | 64K | |
![[IMG]](/icons/image2.gif) | dream6.bmp | 2020-08-11 14:00 | 1.0M | |
![[IMG]](/icons/image2.gif) | dream6.JPG | 2020-08-11 14:00 | 3.3K | |
![[IMG]](/icons/image2.gif) | dream5.bmp | 2020-08-11 14:00 | 1.0M | |
![[IMG]](/icons/image2.gif) | dream5.JPG | 2020-08-11 14:00 | 9.1K | |
![[IMG]](/icons/image2.gif) | dream4.bmp | 2020-08-11 14:00 | 1.0M | |
![[IMG]](/icons/image2.gif) | dream4.JPG | 2020-08-11 14:00 | 7.4K | |
![[IMG]](/icons/image2.gif) | dream3.bmp | 2020-08-11 14:00 | 1.0M | |
![[IMG]](/icons/image2.gif) | dream3.JPG | 2020-08-11 14:00 | 5.8K | |
![[IMG]](/icons/image2.gif) | dream2.bmp | 2020-08-11 14:00 | 1.0M | |
![[IMG]](/icons/image2.gif) | dream2.JPG | 2020-08-11 14:00 | 6.2K | |
![[IMG]](/icons/image2.gif) | dream1.bmp | 2020-08-11 14:00 | 1.0M | |
![[IMG]](/icons/image2.gif) | dream1.JPG | 2020-08-11 14:00 | 4.0K | |
![[DIR]](/icons/folder.gif) | docs/ | 2020-08-11 14:00 | - | |
![[ ]](/icons/unknown.gif) | depcomp | 2020-08-11 14:00 | 16K | |
![[TXT]](/icons/text.gif) | deepsettpress.html | 2020-08-11 14:00 | 321 | |
![[IMG]](/icons/image2.gif) | deepsett.jpg | 2020-08-11 14:00 | 77K | |
![[IMG]](/icons/image2.gif) | deep_sett_2.gif | 2020-08-11 14:00 | 23K | |
![[IMG]](/icons/image2.gif) | deep_sett_1.gif | 2020-08-11 14:00 | 14K | |
![[IMG]](/icons/image2.gif) | dance 8.JPG | 2020-08-11 14:00 | 12K | |
![[IMG]](/icons/image2.gif) | dance 7.JPG | 2020-08-11 14:00 | 36K | |
![[IMG]](/icons/image2.gif) | dance 6.JPG | 2020-08-11 14:00 | 27K | |
![[IMG]](/icons/image2.gif) | dance 5.JPG | 2020-08-11 14:00 | 28K | |
![[IMG]](/icons/image2.gif) | dance 4.JPG | 2020-08-11 14:00 | 26K | |
![[IMG]](/icons/image2.gif) | dance 3.JPG | 2020-08-11 14:00 | 31K | |
![[IMG]](/icons/image2.gif) | dance 2.JPG | 2020-08-11 14:00 | 31K | |
![[IMG]](/icons/image2.gif) | dance 1.JPG | 2020-08-11 14:00 | 39K | |
![[VID]](/icons/movie.gif) | dance.wmv | 2020-08-11 14:00 | 7.4M | |
![[TXT]](/icons/text.gif) | dance.html | 2020-08-11 14:00 | 1.8K | |
![[IMG]](/icons/image2.gif) | cruise.jpg | 2020-08-11 14:00 | 5.8K | |
![[IMG]](/icons/image2.gif) | couch3.JPG | 2020-08-11 14:00 | 88K | |
![[IMG]](/icons/image2.gif) | couch3-cropped.JPG | 2020-08-11 14:00 | 68K | |
![[IMG]](/icons/image2.gif) | couch2.JPG | 2020-08-11 14:00 | 70K | |
![[IMG]](/icons/image2.gif) | couch2-cropped.JPG | 2020-08-11 14:00 | 59K | |
![[IMG]](/icons/image2.gif) | couch1.JPG | 2020-08-11 14:00 | 86K | |
![[IMG]](/icons/image2.gif) | couch1-cropped.JPG | 2020-08-11 14:00 | 76K | |
![[ ]](/icons/unknown.gif) | configure.ac | 2020-08-11 14:00 | 3.2K | |
![[ ]](/icons/unknown.gif) | configure | 2020-08-11 14:00 | 681K | |
![[ ]](/icons/unknown.gif) | config.sub | 2020-08-11 14:00 | 31K | |
![[ ]](/icons/unknown.gif) | config.guess | 2020-08-11 14:00 | 42K | |
![[IMG]](/icons/image2.gif) | claw.gif | 2020-08-11 14:00 | 5.2K | |
![[IMG]](/icons/image2.gif) | changed.gif | 2020-08-11 14:00 | 1.4K | |
![[IMG]](/icons/image2.gif) | change.gif | 2020-08-11 14:00 | 1.3K | |
![[IMG]](/icons/image2.gif) | chair.jpg | 2020-08-11 14:00 | 14K | |
![[IMG]](/icons/image2.gif) | cards.jpg | 2020-08-11 14:00 | 9.8K | |
![[DIR]](/icons/folder.gif) | cache/ | 2020-08-11 14:00 | - | |
![[IMG]](/icons/image2.gif) | bush.jpg | 2020-08-11 14:00 | 7.5K | |
![[IMG]](/icons/image2.gif) | buildings22.JPG | 2020-08-11 14:00 | 143K | |
![[IMG]](/icons/image2.gif) | buildings16.JPG | 2020-08-11 14:00 | 111K | |
![[IMG]](/icons/image2.gif) | buildings14.JPG | 2020-08-11 14:00 | 105K | |
![[IMG]](/icons/image2.gif) | buildings12.JPG | 2020-08-11 14:00 | 82K | |
![[IMG]](/icons/image2.gif) | buff-my-dome.gif | 2020-08-11 14:00 | 2.7K | |
![[IMG]](/icons/image2.gif) | buck-teeth.jpg | 2020-08-11 14:00 | 22K | |
![[IMG]](/icons/image2.gif) | bridge.JPG | 2020-08-11 14:00 | 130K | |
![[DIR]](/icons/folder.gif) | bin/ | 2020-08-11 14:00 | - | |
![[IMG]](/icons/image2.gif) | big robin.jpg | 2020-08-11 14:00 | 11K | |
![[IMG]](/icons/image2.gif) | bigmagic.jpg | 2020-08-11 14:00 | 40K | |
![[TXT]](/icons/text.gif) | behind-the-scenes25.html | 2020-08-11 14:00 | 592 | |
![[TXT]](/icons/text.gif) | behind-the-scenes24.html | 2020-08-11 14:00 | 591 | |
![[TXT]](/icons/text.gif) | behind-the-scenes23.html | 2020-08-11 14:00 | 595 | |
![[TXT]](/icons/text.gif) | behind-the-scenes22.html | 2020-08-11 14:00 | 590 | |
![[TXT]](/icons/text.gif) | behind-the-scenes21.html | 2020-08-11 14:00 | 583 | |
![[TXT]](/icons/text.gif) | behind-the-scenes20.html | 2020-08-11 14:00 | 594 | |
![[TXT]](/icons/text.gif) | behind-the-scenes19.html | 2020-08-11 14:00 | 590 | |
![[TXT]](/icons/text.gif) | behind-the-scenes18.html | 2020-08-11 14:00 | 585 | |
![[TXT]](/icons/text.gif) | behind-the-scenes17.html | 2020-08-11 14:00 | 593 | |
![[TXT]](/icons/text.gif) | behind-the-scenes16.html | 2020-08-11 14:00 | 584 | |
![[TXT]](/icons/text.gif) | behind-the-scenes15.html | 2020-08-11 14:00 | 597 | |
![[TXT]](/icons/text.gif) | behind-the-scenes14.html | 2020-08-11 14:00 | 585 | |
![[TXT]](/icons/text.gif) | behind-the-scenes13.html | 2020-08-11 14:00 | 596 | |
![[TXT]](/icons/text.gif) | behind-the-scenes12.html | 2020-08-11 14:00 | 589 | |
![[TXT]](/icons/text.gif) | behind-the-scenes11.html | 2020-08-11 14:00 | 585 | |
![[TXT]](/icons/text.gif) | behind-the-scenes10.html | 2020-08-11 14:00 | 598 | |
![[TXT]](/icons/text.gif) | behind-the-scenes9.html | 2020-08-11 14:00 | 586 | |
![[TXT]](/icons/text.gif) | behind-the-scenes8.html | 2020-08-11 14:00 | 582 | |
![[TXT]](/icons/text.gif) | behind-the-scenes7.html | 2020-08-11 14:00 | 588 | |
![[TXT]](/icons/text.gif) | behind-the-scenes6.html | 2020-08-11 14:00 | 588 | |
![[TXT]](/icons/text.gif) | behind-the-scenes5.html | 2020-08-11 14:00 | 588 | |
![[TXT]](/icons/text.gif) | behind-the-scenes4.html | 2020-08-11 14:00 | 588 | |
![[TXT]](/icons/text.gif) | behind-the-scenes3.html | 2020-08-11 14:00 | 583 | |
![[TXT]](/icons/text.gif) | behind-the-scenes2.html | 2020-08-11 14:00 | 586 | |
![[TXT]](/icons/text.gif) | behind-the-scenes1.html | 2020-08-11 14:00 | 589 | |
![[TXT]](/icons/text.gif) | behind-the-scenes.html | 2020-08-11 14:00 | 581 | |
![[IMG]](/icons/image2.gif) | behind-the-scenes.bmp | 2020-08-11 14:00 | 8.3K | |
![[IMG]](/icons/image2.gif) | axe.JPG | 2020-08-11 14:00 | 17K | |
![[IMG]](/icons/image2.gif) | august-15.bmp | 2020-08-11 14:00 | 25K | |
![[IMG]](/icons/image2.gif) | ata.gif | 2020-08-11 14:00 | 2.9K | |
![[IMG]](/icons/image2.gif) | argument.jpg | 2020-08-11 14:00 | 8.6K | |
![[ ]](/icons/unknown.gif) | api.php5 | 2020-08-11 14:00 | 25 | |
![[ ]](/icons/unknown.gif) | api.php | 2020-08-11 14:00 | 4.7K | |
![[IMG]](/icons/image2.gif) | anna headshot.jpg | 2020-08-11 14:00 | 111K | |
![[IMG]](/icons/image2.gif) | anna.bmp | 2020-08-11 14:00 | 6.1K | |
![[IMG]](/icons/image2.gif) | anna-text.bmp | 2020-08-11 14:00 | 57K | |
![[IMG]](/icons/image2.gif) | anna-headshot3.JPG | 2020-08-11 14:00 | 37K | |
![[IMG]](/icons/image2.gif) | anna-headshot2.jpg | 2020-08-11 14:00 | 313K | |
![[IMG]](/icons/image2.gif) | ana.JPG | 2020-08-11 14:00 | 78K | |
![[IMG]](/icons/image2.gif) | ana-robin.JPG | 2020-08-11 14:00 | 68K | |
![[IMG]](/icons/image2.gif) | ana-backlight.JPG | 2020-08-11 14:00 | 68K | |
![[IMG]](/icons/image2.gif) | amanda-small.bmp | 2020-08-11 14:00 | 155K | |
![[IMG]](/icons/image2.gif) | agent-smith.gif | 2020-08-11 14:00 | 5.0K | |
![[ ]](/icons/unknown.gif) | aclocal.m4 | 2020-08-11 14:00 | 255K | |
![[ ]](/icons/unknown.gif) | UPGRADE | 2020-08-11 14:00 | 11K | |
![[ ]](/icons/unknown.gif) | StartProfiler.sample | 2020-08-11 14:00 | 408 | |
![[VID]](/icons/movie.gif) | Sabine Preview.wmv | 2020-08-11 14:00 | 2.7M | |
![[VID]](/icons/movie.gif) | Rough assembly 2.wmv | 2020-08-11 14:00 | 352K | |
![[VID]](/icons/movie.gif) | Rough-assembly-2.wmv | 2020-08-11 14:00 | 28M | |
![[VID]](/icons/movie.gif) | Robin Mocumentary 8-6-04.mov | 2020-08-11 14:00 | 24M | |
![[IMG]](/icons/image2.gif) | Robin Dunn still.jpg | 2020-08-11 14:00 | 4.5K | |
![[VID]](/icons/movie.gif) | Rape of the Sabine Women.wmv | 2020-08-11 14:00 | 37M | |
![[ ]](/icons/unknown.gif) | RELEASE-NOTES-1.19 | 2020-08-11 14:00 | 25K | |
![[ ]](/icons/hand.right.gif) | README | 2020-08-11 14:00 | 4.0K | |
![[VID]](/icons/movie.gif) | Post-Gibran-dialup.wmv | 2020-08-11 14:00 | 665K | |
![[VID]](/icons/movie.gif) | Post-Gibran-broadband.wmv | 2020-08-11 14:00 | 16M | |
![[IMG]](/icons/image2.gif) | Paul-BW.jpg | 2020-08-11 14:00 | 15K | |
![[ ]](/icons/unknown.gif) | Out on the Edge SIDES.doc | 2020-08-11 14:00 | 36K | |
![[TXT]](/icons/text.gif) | On the Edge.txt | 2020-08-11 14:00 | 2.3K | |
![[VID]](/icons/movie.gif) | Mocumentary - Encoded Short Version.wmv | 2020-08-11 14:00 | 3.0M | |
![[VID]](/icons/movie.gif) | Mocumentary - Encoded Long Version.wmv | 2020-08-11 14:00 | 8.9M | |
![[ ]](/icons/unknown.gif) | Makefile.in | 2020-08-11 14:00 | 28K | |
![[ ]](/icons/unknown.gif) | Makefile.am | 2020-08-11 14:00 | 567 | |
![[IMG]](/icons/image2.gif) | Julia still.jpg | 2020-08-11 14:00 | 5.9K | |
![[VID]](/icons/movie.gif) | Inside Preview.wmv | 2020-08-11 14:00 | 3.4M | |
![[IMG]](/icons/image2.gif) | Inside.JPG | 2020-08-11 14:00 | 13K | |
![[ ]](/icons/unknown.gif) | INSTALL | 2020-08-11 14:00 | 3.3K | |
![[TXT]](/icons/text.gif) | Humanities Humans.html | 2020-08-11 14:00 | 2.2K | |
![[ ]](/icons/unknown.gif) | HISTORY | 2020-08-11 14:00 | 509K | |
![[ ]](/icons/unknown.gif) | FAQ | 2020-08-11 14:00 | 76 | |
![[ ]](/icons/unknown.gif) | CREDITS | 2020-08-11 14:00 | 3.0K | |
![[ ]](/icons/unknown.gif) | COPYING | 2020-08-11 14:00 | 17K | |
![[IMG]](/icons/image2.gif) | 2-shot.jpg | 2020-08-11 14:00 | 9.0K | |
|