![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/unknown.gif) | thumb.php5 | 2020-08-11 14:00 | 29 | |
![[IMG]](/icons/image2.gif) | montage 2.JPG | 2020-08-11 14:00 | 26K | |
| gotterdammerung.jpg | 2020-08-11 14:00 | 12K | |
![[TXT]](/icons/text.gif) | under-a-dream.html | 2020-08-11 14:00 | 2.0K | |
| argument.jpg | 2020-08-11 14:00 | 8.6K | |
| Robin Dunn still.jpg | 2020-08-11 14:00 | 4.5K | |
![[VID]](/icons/movie.gif) | Post-Gibran-dialup.wmv | 2020-08-11 14:00 | 665K | |
| roughcut screening.GIF | 2020-08-11 14:00 | 3.1K | |
| buildings22.JPG | 2020-08-11 14:00 | 143K | |
| dance 1.JPG | 2020-08-11 14:00 | 39K | |
| claw.gif | 2020-08-11 14:00 | 5.2K | |
| zellweger-dialup.wmv | 2020-08-11 14:00 | 1.7M | |
| ana-backlight.JPG | 2020-08-11 14:00 | 68K | |
| dream5.bmp | 2020-08-11 14:00 | 1.0M | |
| photos5.html | 2020-08-11 14:00 | 568 | |
| no.gif | 2020-08-11 14:00 | 969 | |
| couch3.JPG | 2020-08-11 14:00 | 88K | |
| couch1-cropped.JPG | 2020-08-11 14:00 | 76K | |
![[DIR]](/icons/folder.gif) | bin/ | 2020-08-11 14:00 | - | |
| CREDITS | 2020-08-11 14:00 | 3.0K | |
| wilderness.html | 2020-08-11 14:00 | 595 | |
| photos.html | 2020-08-11 14:00 | 562 | |
| dance 5.JPG | 2020-08-11 14:00 | 28K | |
| behind-the-scenes9.html | 2020-08-11 14:00 | 586 | |
| window.JPG | 2020-08-11 14:00 | 85K | |
| deepsettpress.html | 2020-08-11 14:00 | 321 | |
| bush.jpg | 2020-08-11 14:00 | 7.5K | |
| behind-the-scenes6.html | 2020-08-11 14:00 | 588 | |
| underneath1.JPG | 2020-08-11 14:00 | 6.9K | |
| photos8.html | 2020-08-11 14:00 | 569 | |
| behind-the-scenes10.html | 2020-08-11 14:00 | 598 | |
| HISTORY | 2020-08-11 14:00 | 509K | |
| robin-and-dylan.JPG | 2020-08-11 14:00 | 86K | |
| tags3-cropped.JPG | 2020-08-11 14:00 | 68K | |
| sqlite3.pc.in | 2020-08-11 14:00 | 267 | |
| tags2.JPG | 2020-08-11 14:00 | 91K | |
| humanities.html | 2020-08-11 14:00 | 290 | |
| sqlite3.c | 2020-08-11 14:00 | 4.6M | |
| shell.c | 2020-08-11 14:00 | 94K | |
| okay.gif | 2020-08-11 14:00 | 1.5K | |
| starmontage.jpg | 2020-08-11 14:00 | 24K | |
| underneath3-big.JPG | 2020-08-11 14:00 | 22K | |
| redirect.php5 | 2020-08-11 14:00 | 31 | |
| Rough assembly 2.wmv | 2020-08-11 14:00 | 352K | |
| sqlite3.h | 2020-08-11 14:00 | 332K | |
| underneath2.JPG | 2020-08-11 14:00 | 6.3K | |
| dance 3.JPG | 2020-08-11 14:00 | 31K | |
| underneath.wmv | 2020-08-11 14:00 | 23M | |
| ltmain.sh | 2020-08-11 14:00 | 194K | |
| party2.JPG | 2020-08-11 14:00 | 80K | |
| tags1-cropped.JPG | 2020-08-11 14:00 | 55K | |
| still1.JPG | 2020-08-11 14:00 | 8.7K | |
| dance.html | 2020-08-11 14:00 | 1.8K | |
| bridge.JPG | 2020-08-11 14:00 | 130K | |
| trophy.bmp | 2020-08-11 14:00 | 146K | |
| StartProfiler.sample | 2020-08-11 14:00 | 408 | |
| configure | 2020-08-11 14:00 | 681K | |
| resources/ | 2020-08-11 14:00 | - | |
| gotterdammerung-dialup.mov | 2020-08-11 14:00 | 27M | |
| 2-shot.jpg | 2020-08-11 14:00 | 9.0K | |
| wilderness.rtf | 2020-08-11 14:00 | 445K | |
| under-a-dream3.bmp | 2020-08-11 14:00 | 167K | |
| changed.gif | 2020-08-11 14:00 | 1.4K | |
| buff-my-dome.gif | 2020-08-11 14:00 | 2.7K | |
| window-cropped.JPG | 2020-08-11 14:00 | 59K | |
| still2.JPG | 2020-08-11 14:00 | 12K | |
| chair.jpg | 2020-08-11 14:00 | 14K | |
| photos10.html | 2020-08-11 14:00 | 568 | |
| bigmagic.jpg | 2020-08-11 14:00 | 40K | |
| behind-the-scenes3.html | 2020-08-11 14:00 | 583 | |
| dream4.bmp | 2020-08-11 14:00 | 1.0M | |
| yes.gif | 2020-08-11 14:00 | 1.0K | |
| trophy.html | 2020-08-11 14:00 | 1.5K | |
| still8.JPG | 2020-08-11 14:00 | 9.3K | |
| paul.bmp | 2020-08-11 14:00 | 9.5K | |
| or.gif | 2020-08-11 14:00 | 901 | |
| magic.jpg | 2020-08-11 14:00 | 14K | |
| wall street.gif | 2020-08-11 14:00 | 1.6K | |
| ata.gif | 2020-08-11 14:00 | 2.9K | |
| RELEASE-NOTES-1.19 | 2020-08-11 14:00 | 25K | |
| serialized/ | 2020-08-11 14:00 | - | |
| buildings16.JPG | 2020-08-11 14:00 | 111K | |
| why-zellweger.html | 2020-08-11 14:00 | 2.1K | |
| tired.gif | 2020-08-11 14:00 | 1.4K | |
| sqlite3ext.h | 2020-08-11 14:00 | 24K | |
| cruise.jpg | 2020-08-11 14:00 | 5.8K | |
| behind-the-scenes7.html | 2020-08-11 14:00 | 588 | |
| g-man.html | 2020-08-11 14:00 | 287 | |
| behind-the-scenes17.html | 2020-08-11 14:00 | 593 | |
| api.php5 | 2020-08-11 14:00 | 25 | |
| anna-headshot3.JPG | 2020-08-11 14:00 | 37K | |
| On the Edge.txt | 2020-08-11 14:00 | 2.3K | |
| extensions/ | 2020-08-11 14:00 | - | |
| wilderness sides.doc | 2020-08-11 14:00 | 34K | |
| still4.JPG | 2020-08-11 14:00 | 16K | |
| inside.html | 2020-08-11 14:00 | 1.8K | |
| behind-the-scenes4.html | 2020-08-11 14:00 | 588 | |
| anna-text.bmp | 2020-08-11 14:00 | 57K | |
| listedat_12060_grey.gif | 2020-08-11 14:00 | 858 | |
| languages/ | 2020-08-11 14:00 | - | |
| change.gif | 2020-08-11 14:00 | 1.3K | |
| sword_master.jpg | 2020-08-11 14:00 | 28K | |
| redline2.jpg | 2020-08-11 14:00 | 1.5K | |
| picture-strip.JPG | 2020-08-11 14:00 | 31K | |
| left_arrow.jpg | 2020-08-11 14:00 | 924 | |
| index.html | 2020-08-11 14:00 | 559 | |
| naked signing.jpg | 2020-08-11 14:00 | 13K | |
| behind-the-scenes1.html | 2020-08-11 14:00 | 589 | |
| dream3.bmp | 2020-08-11 14:00 | 1.0M | |
| set3-smaller.jpg | 2020-08-11 14:00 | 66K | |
| dream4.JPG | 2020-08-11 14:00 | 7.4K | |
| thumb_handler.php | 2020-08-11 14:00 | 229 | |
| removed-content-bigbadgerjohnny/ | 2020-08-11 14:00 | - | |
| thumb.php | 2020-08-11 14:00 | 9.4K | |
| montage 4.JPG | 2020-08-11 14:00 | 26K | |
| behind-the-scenes16.html | 2020-08-11 14:00 | 584 | |
| photos.bmp | 2020-08-11 14:00 | 3.6K | |
| gotterdammerung-broadband.wmv | 2020-08-11 14:00 | 48M | |
| under-a-dream3.JPG | 2020-08-11 14:00 | 7.9K | |
| main2.jpg | 2020-08-11 14:00 | 1.5K | |
| dream5.JPG | 2020-08-11 14:00 | 9.1K | |
| behind-the-scenes12.html | 2020-08-11 14:00 | 589 | |
| robin.html | 2020-08-11 14:00 | 935 | |
| redline.jpg | 2020-08-11 14:00 | 1.6K | |
| guidelines.gif | 2020-08-11 14:00 | 1.7K | |
| behind-the-scenes13.html | 2020-08-11 14:00 | 596 | |
| Humanities Humans.html | 2020-08-11 14:00 | 2.2K | |
| head-like-a-light.JPG | 2020-08-11 14:00 | 57K | |
| install-sh | 2020-08-11 14:00 | 9.0K | |
| inside.wmv | 2020-08-11 14:00 | 15M | |
| dream1.JPG | 2020-08-11 14:00 | 4.0K | |
| reporter-scene.JPG | 2020-08-11 14:00 | 106K | |
| opensearch_desc.php5 | 2020-08-11 14:00 | 39 | |
| montage-2-smaller.JPG | 2020-08-11 14:00 | 8.0K | |
| dance 6.JPG | 2020-08-11 14:00 | 27K | |
| Out on the Edge SIDES.doc | 2020-08-11 14:00 | 36K | |
| dream1.bmp | 2020-08-11 14:00 | 1.0M | |
| people.html | 2020-08-11 14:00 | 824 | |
| configure.ac | 2020-08-11 14:00 | 3.2K | |
| COPYING | 2020-08-11 14:00 | 17K | |
| buildings12.JPG | 2020-08-11 14:00 | 82K | |
| opensearch_desc.php | 2020-08-11 14:00 | 3.0K | |
| load.php | 2020-08-11 14:00 | 1.8K | |
| FAQ | 2020-08-11 14:00 | 76 | |
| tags1.JPG | 2020-08-11 14:00 | 73K | |
| selection.gif | 2020-08-11 14:00 | 1.4K | |
| photos2.html | 2020-08-11 14:00 | 560 | |
| dylan-white-to-black.JPG | 2020-08-11 14:00 | 81K | |
| big robin.jpg | 2020-08-11 14:00 | 11K | |
| dylan.JPG | 2020-08-11 14:00 | 81K | |
| zellweger.jpg | 2020-08-11 14:00 | 13K | |
| mcccarthy.jpg | 2020-08-11 14:00 | 5.8K | |
| good-cigar.JPG | 2020-08-11 14:00 | 68K | |
| under a dream- rough cut.wmv | 2020-08-11 14:00 | 13M | |
| tags4.JPG | 2020-08-11 14:00 | 89K | |
| main.jpg | 2020-08-11 14:00 | 1.7K | |
| behind-the-scenes11.html | 2020-08-11 14:00 | 585 | |
| cache/ | 2020-08-11 14:00 | - | |
| Robin Mocumentary 8-6-04.mov | 2020-08-11 14:00 | 24M | |
| dream3.JPG | 2020-08-11 14:00 | 5.8K | |
| buck-teeth.jpg | 2020-08-11 14:00 | 22K | |
| amanda-small.bmp | 2020-08-11 14:00 | 155K | |
| dream6.bmp | 2020-08-11 14:00 | 1.0M | |
| montage 3.JPG | 2020-08-11 14:00 | 24K | |
| sqlite3.1 | 2020-08-11 14:00 | 6.6K | |
| small galaxy.jpg | 2020-08-11 14:00 | 7.1K | |
| promo-stills.bmp | 2020-08-11 14:00 | 6.3K | |
| underneath-stream.wmv | 2020-08-11 14:00 | 11M | |
| nun.jpg | 2020-08-11 14:00 | 15K | |
| underneath-stream.mov | 2020-08-11 14:00 | 74M | |
| zellweger-broadband.wmv | 2020-08-11 14:00 | 33M | |
| dream2.JPG | 2020-08-11 14:00 | 6.2K | |
| underneath3.JPG | 2020-08-11 14:00 | 5.2K | |
| main.html | 2020-08-11 14:00 | 3.6K | |
| dream6.JPG | 2020-08-11 14:00 | 3.3K | |
| anna headshot.jpg | 2020-08-11 14:00 | 111K | |
| behind-the-scenes8.html | 2020-08-11 14:00 | 582 | |
| api.php | 2020-08-11 14:00 | 4.7K | |
| Inside.JPG | 2020-08-11 14:00 | 13K | |
| robin-text.bmp | 2020-08-11 14:00 | 40K | |
| reagan.gif | 2020-08-11 14:00 | 1.2K | |
| img_auth.php5 | 2020-08-11 14:00 | 31 | |
| gibberish.txt | 2020-08-11 14:00 | 5.6K | |
| depcomp | 2020-08-11 14:00 | 16K | |
| axe.JPG | 2020-08-11 14:00 | 17K | |
| test.gif | 2020-08-11 14:00 | 5.8K | |
| natasha_and_elizabeth.doc | 2020-08-11 14:00 | 30K | |
| zellweger-dialup.mov | 2020-08-11 14:00 | 31M | |
| sqlite3.pc | 2020-08-11 14:00 | 278 | |
| photos6.html | 2020-08-11 14:00 | 560 | |
| photos4.html | 2020-08-11 14:00 | 560 | |
| newspaper still.jpg | 2020-08-11 14:00 | 11K | |
| paul-ana-backlight.JPG | 2020-08-11 14:00 | 53K | |
| upset hag.jpg | 2020-08-11 14:00 | 5.7K | |
| robin4.jpg | 2020-08-11 14:00 | 61K | |
| behind-the-scenes25.html | 2020-08-11 14:00 | 592 | |
| under-a-dream.wmv | 2020-08-11 14:00 | 11M | |
| img_auth.php | 2020-08-11 14:00 | 5.1K | |
| dance 2.JPG | 2020-08-11 14:00 | 31K | |
| promotional.jpg | 2020-08-11 14:00 | 34K | |
| just-in.jpg | 2020-08-11 14:00 | 28K | |
| behind-the-scenes2.html | 2020-08-11 14:00 | 586 | |
| underneath4.JPG | 2020-08-11 14:00 | 3.4K | |
| mw-config/ | 2020-08-11 14:00 | - | |
| missing | 2020-08-11 14:00 | 11K | |
| behind-the-scenes14.html | 2020-08-11 14:00 | 585 | |
| naked montage.jpg | 2020-08-11 14:00 | 27K | |
| Julia still.jpg | 2020-08-11 14:00 | 5.9K | |
| tea/ | 2020-08-11 14:00 | - | |
| paul-text.bmp | 2020-08-11 14:00 | 74K | |
| behind-the-scenes.html | 2020-08-11 14:00 | 581 | |
| anna-headshot2.jpg | 2020-08-11 14:00 | 313K | |
| index.html.orig | 2020-08-11 14:00 | 559 | |
| behind-the-scenes.bmp | 2020-08-11 14:00 | 8.3K | |
| why-body-boundary.html | 2020-08-11 14:00 | 2.2K | |
| thumb_handler.php5 | 2020-08-11 14:00 | 37 | |
| sarah.jpg | 2020-08-11 14:00 | 13K | |
| behind-the-scenes15.html | 2020-08-11 14:00 | 597 | |
| Paul-BW.jpg | 2020-08-11 14:00 | 15K | |
| couch2.JPG | 2020-08-11 14:00 | 70K | |
| agent-smith.gif | 2020-08-11 14:00 | 5.0K | |
| docs/ | 2020-08-11 14:00 | - | |
| morefilms.html | 2020-08-11 14:00 | 1.3K | |
| main3.bmp | 2020-08-11 14:00 | 6.4K | |
| gotterdammerung.html | 2020-08-11 14:00 | 2.4K | |
| reversal.jpg | 2020-08-11 14:00 | 7.7K | |
| photos-big.bmp | 2020-08-11 14:00 | 8.8K | |
| maintenance/ | 2020-08-11 14:00 | - | |
| UPGRADE | 2020-08-11 14:00 | 11K | |
| still7.JPG | 2020-08-11 14:00 | 19K | |
| robin5.JPG | 2020-08-11 14:00 | 3.6K | |
| lareview2.html | 2020-08-11 14:00 | 702 | |
| aclocal.m4 | 2020-08-11 14:00 | 255K | |
| welcome.html | 2020-08-11 14:00 | 1.7K | |
| redirect.phtml | 2020-08-11 14:00 | 89 | |
| promo_shot.jpg | 2020-08-11 14:00 | 57K | |
| profileinfo.php | 2020-08-11 14:00 | 9.2K | |
| gazebo.JPG | 2020-08-11 14:00 | 125K | |
| photos.jpg | 2020-08-11 14:00 | 23K | |
| Mocumentary - Encoded Short Version.wmv | 2020-08-11 14:00 | 3.0M | |
| Sabine Preview.wmv | 2020-08-11 14:00 | 2.7M | |
| robin2.JPG | 2020-08-11 14:00 | 149K | |
| montage 5.JPG | 2020-08-11 14:00 | 36K | |
| montage 6.JPG | 2020-08-11 14:00 | 26K | |
| deepsett.jpg | 2020-08-11 14:00 | 77K | |
![[ ]](/icons/hand.right.gif) | README | 2020-08-11 14:00 | 4.0K | |
| right_arrow.jpg | 2020-08-11 14:00 | 914 | |
| rain1_small.jpg | 2020-08-11 14:00 | 33K | |
| news.bmp | 2020-08-11 14:00 | 3.2K | |
| cards.jpg | 2020-08-11 14:00 | 9.8K | |
| Inside Preview.wmv | 2020-08-11 14:00 | 3.4M | |
| redirect.php | 2020-08-11 14:00 | 510 | |
| includes/ | 2020-08-11 14:00 | - | |
| sqlite3 | 2020-08-11 14:00 | 456K | |
| photos9.html | 2020-08-11 14:00 | 570 | |
| under-a-dream2.wmv | 2020-08-11 14:00 | 30M | |
| order.html | 2020-08-11 14:00 | 3.5K | |
| reagan1.gif | 2020-08-11 14:00 | 4.8K | |
| dance 8.JPG | 2020-08-11 14:00 | 12K | |
| behind-the-scenes20.html | 2020-08-11 14:00 | 594 | |
| lakeside park meeting.JPG | 2020-08-11 14:00 | 76K | |
| dylan-CU.JPG | 2020-08-11 14:00 | 64K | |
| robin.bmp | 2020-08-11 14:00 | 8.1K | |
| fun-haver.gif | 2020-08-11 14:00 | 2.5K | |
| behind-the-scenes23.html | 2020-08-11 14:00 | 595 | |
| behind-the-scenes22.html | 2020-08-11 14:00 | 590 | |
| wiki.db | 2020-08-11 14:00 | 0 | |
| robin-light.JPG | 2020-08-11 14:00 | 91K | |
| naked front still.jpg | 2020-08-11 14:00 | 8.2K | |
| anna.bmp | 2020-08-11 14:00 | 6.1K | |
| rain_small.jpg | 2020-08-11 14:00 | 30K | |
| text_pic.jpg | 2020-08-11 14:00 | 53K | |
| INSTALL | 2020-08-11 14:00 | 3.3K | |
| deep_sett_2.gif | 2020-08-11 14:00 | 23K | |
| couch2-cropped.JPG | 2020-08-11 14:00 | 59K | |
| zellweger.html | 2020-08-11 14:00 | 2.2K | |
| one_morning.doc | 2020-08-11 14:00 | 137K | |
| humanities - small.JPG | 2020-08-11 14:00 | 6.8K | |
| still9.JPG | 2020-08-11 14:00 | 14K | |
| set2.jpg | 2020-08-11 14:00 | 137K | |
| no.html | 2020-08-11 14:00 | 725 | |
| newspaper.jpg | 2020-08-11 14:00 | 2.6K | |
| index.php5 | 2020-08-11 14:00 | 29 | |
| config.sub | 2020-08-11 14:00 | 31K | |
| phone.JPG | 2020-08-11 14:00 | 81K | |
| Post-Gibran-broadband.wmv | 2020-08-11 14:00 | 16M | |
| humanities preview.wmv | 2020-08-11 14:00 | 2.7M | |
| promo1.jpg | 2020-08-11 14:00 | 127K | |
| Rape of the Sabine Women.wmv | 2020-08-11 14:00 | 37M | |
| kelly-small.bmp | 2020-08-11 14:00 | 162K | |
| ana.JPG | 2020-08-11 14:00 | 78K | |
| behind-the-scenes18.html | 2020-08-11 14:00 | 585 | |
| tests/ | 2020-08-11 14:00 | - | |
| under-a-dream.JPG | 2020-08-11 14:00 | 15K | |
| photos3.html | 2020-08-11 14:00 | 568 | |
| behind-the-scenes24.html | 2020-08-11 14:00 | 591 | |
| wiki.phtml | 2020-08-11 14:00 | 86 | |
| photos7.html | 2020-08-11 14:00 | 569 | |
| people.jpg | 2020-08-11 14:00 | 23K | |
| index.php | 2020-08-11 14:00 | 2.3K | |
| government agent.gif | 2020-08-11 14:00 | 1.3K | |
| couch3-cropped.JPG | 2020-08-11 14:00 | 68K | |
| trophy.wmv | 2020-08-11 14:00 | 91M | |
| Mocumentary - Encoded Long Version.wmv | 2020-08-11 14:00 | 8.9M | |
| ideology.html | 2020-08-11 14:00 | 6.1K | |
| ideological model.gif | 2020-08-11 14:00 | 1.7K | |
| buildings14.JPG | 2020-08-11 14:00 | 105K | |
| marlyse-small.bmp | 2020-08-11 14:00 | 144K | |
| couch1.JPG | 2020-08-11 14:00 | 86K | |
| photos-gallery.html | 2020-08-11 14:00 | 660 | |
| august-15.bmp | 2020-08-11 14:00 | 25K | |
| ana-robin.JPG | 2020-08-11 14:00 | 68K | |
| why-gotterdammerung.html | 2020-08-11 14:00 | 1.0K | |
| still6.JPG | 2020-08-11 14:00 | 15K | |
| dance 4.JPG | 2020-08-11 14:00 | 26K | |
| behind-the-scenes21.html | 2020-08-11 14:00 | 583 | |
| underneath5.JPG | 2020-08-11 14:00 | 4.3K | |
| skins/ | 2020-08-11 14:00 | - | |
| shoe.jpg | 2020-08-11 14:00 | 11K | |
| galaxy.jpg | 2020-08-11 14:00 | 3.5K | |
| robin-the-boxer.JPG | 2020-08-11 14:00 | 78K | |
| stairs-tree.JPG | 2020-08-11 14:00 | 93K | |
| small galaxy robin.jpg | 2020-08-11 14:00 | 7.2K | |
| robin-pinkshirt.JPG | 2020-08-11 14:00 | 36K | |
| hand climbing.jpg | 2020-08-11 14:00 | 8.1K | |
| deep_sett_1.gif | 2020-08-11 14:00 | 14K | |
| tags3.JPG | 2020-08-11 14:00 | 77K | |
| dance.wmv | 2020-08-11 14:00 | 7.4M | |
| naked running.jpg | 2020-08-11 14:00 | 7.0K | |
| dream2.bmp | 2020-08-11 14:00 | 1.0M | |
| behind-the-scenes19.html | 2020-08-11 14:00 | 590 | |
| welcomepitch.gif | 2020-08-11 14:00 | 44K | |
| news.html | 2020-08-11 14:00 | 1.2K | |
| Rough-assembly-2.wmv | 2020-08-11 14:00 | 28M | |
| promo2.jpg | 2020-08-11 14:00 | 125K | |
| marriage-deadline.html | 2020-08-11 14:00 | 1.8K | |
| load.php5 | 2020-08-11 14:00 | 27 | |
| images/ | 2020-08-11 14:00 | - | |
| gotterdammerung-dialup.wmv | 2020-08-11 14:00 | 1.2M | |
| montage 1.JPG | 2020-08-11 14:00 | 23K | |
| marriage-deadline.wmv | 2020-08-11 14:00 | 21M | |
| underneath.html | 2020-08-11 14:00 | 1.9K | |
| true-thug-nature.JPG | 2020-08-11 14:00 | 93K | |
| rene.jpg | 2020-08-11 14:00 | 6.8K | |
| Makefile.am | 2020-08-11 14:00 | 567 | |
| config.guess | 2020-08-11 14:00 | 42K | |
| behind-the-scenes5.html | 2020-08-11 14:00 | 588 | |
| dance 7.JPG | 2020-08-11 14:00 | 36K | |
| Makefile.in | 2020-08-11 14:00 | 28K | |
|
|---|
